C16H29NO3SSi — CID 163219344
ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 163219344) has the molecular formula C16H29NO3SSi and a molecular weight of 343.57 g/mol. Its IUPAC name is ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 163219344 |
| Molecular Formula | C16H29NO3SSi |
| Molecular Weight | 343.57 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | ethyl 4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-propan-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(C(C)C)nc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29NO3SSi/c1-9-19-15(18)13-12(17-14(21-13)11(2)3)10-20-22(7,8)16(4,5)6/h11H,9-10H2,1-8H3 |
| InChIKey | FESKUBZLYLYOPV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|