C16H28N2O3Si — CID 131747122
ethyl 2-(aminomethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carboxylate (PubChem CID 131747122) has the molecular formula C16H28N2O3Si and a molecular weight of 324.50 g/mol. Its IUPAC name is ethyl 2-(aminomethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carboxylate.
| Compound Name | ethyl 2-(aminomethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 131747122 |
| Molecular Formula | C16H28N2O3Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | ethyl 2-(aminomethyl)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(CN)nc(CO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H28N2O3Si/c1-7-20-15(19)12-8-13(10-17)18-14(9-12)11-21-22(5,6)16(2,3)4/h8-9H,7,10-11,17H2,1-6H3 |
| InChIKey | HOGWOIKGCDQWKN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|