C47H78N4O8Si4 — CID 174048850
3,5-bis[[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonyl]amino]benzoic acid (PubChem CID 174048850) has the molecular formula C47H78N4O8Si4 and a molecular weight of 939.50 g/mol. Its IUPAC name is 3,5-bis[[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonyl]amino]benzoic acid.
| Compound Name | 3,5-bis[[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174048850 |
| Molecular Formula | C47H78N4O8Si4 |
| Molecular Weight | 939.50 g/mol |
| Exact Mass | 938.49 |
| IUPAC Name | 3,5-bis[[2,6-bis[[tert-butyl(dimethyl)silyl]oxymethyl]pyridine-4-carbonyl]amino]benzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C(=O)Nc2cc(NC(=O)c3cc(CO[Si](C)(C)C(C)(C)C)nc(CO[Si](C)(C)C(C)(C)C)c3)cc(C(=O)O)c2)cc(CO[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C47H78N4O8Si4/c1-44(2,3)60(13,14)56-28-37-21-32(22-38(48-37)29-57-61(15,16)45(4,5)6)41(52)50-35-25-34(43(54)55)26-36(27-35)51-42(53)33-23-39(30-58-62(17,18)46(7,8)9)49-40(24-33)31-59-63(19,20)47(10,11)12/h21-27H,28-31H2,1-20H3,(H,50,52)(H,51,53)(H,54,55) |
| InChIKey | COEBIUISSXIZOX-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.50 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|