C30H48N4O8Si2 — CID 139075343
N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitrophenyl]acetamide (PubChem CID 139075343) has the molecular formula C30H48N4O8Si2 and a molecular weight of 648.91 g/mol. Its IUPAC name is N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitrophenyl]acetamide.
| Compound Name | N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 139075343 |
| Molecular Formula | C30H48N4O8Si2 |
| Molecular Weight | 648.91 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-nitrophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(CO[Si](C)(C)C(C)(C)C)cc([N+](=O)[O-])c1.CC(=O)Nc1cc(CO[Si](C)(C)C(C)(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/2C15H24N2O4Si/c2*1-11(18)16-13-7-12(8-14(9-13)17(19)20)10-21-22(5,6)15(2,3)4/h2*7-9H,10H2,1-6H3,(H,16,18) |
| InChIKey | ALTATXGKZAXVEY-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.91 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|