C22H30Cl2N2O6Si — CID 157469000
tert-butyl-[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethoxy]-dimethylsilane;[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol (PubChem CID 157469000) has the molecular formula C22H30Cl2N2O6Si and a molecular weight of 525.53 g/mol. Its IUPAC name is tert-butyl-[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethoxy]-dimethylsilane;[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol.
| Compound Name | tert-butyl-[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethoxy]-dimethylsilane;[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol |
|---|---|
| PubChem CID | 157469000 |
| Molecular Formula | C22H30Cl2N2O6Si |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | tert-butyl-[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethoxy]-dimethylsilane;[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol |
| SMILES | [2H]C([2H])(Cl)c1cc([N+](=O)[O-])cc(C([2H])([2H])O[Si](C)(C)C(C)(C)C)c1.[2H]C([2H])(O)c1cc([N+](=O)[O-])cc(C([2H])([2H])Cl)c1 |
| InChI | InChI=1S/C14H22ClNO3Si.C8H8ClNO3/c1-14(2,3)20(4,5)19-10-12-6-11(9-15)7-13(8-12)16(17)18;9-4-6-1-7(5-11)3-8(2-6)10(12)13/h6-8H,9-10H2,1-5H3;1-3,11H,4-5H2/i9D2,10D2;4D2,5D2 |
| InChIKey | BUUOSTGJXWRKGL-XSZGLUGGSA-N |
| XLogP | 6.68 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|