C17H18Cl2N2O8S — CID 159308339
[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol;[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethyl] methanesulfonate (PubChem CID 159308339) has the molecular formula C17H18Cl2N2O8S and a molecular weight of 489.36 g/mol. Its IUPAC name is [3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol;[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethyl] methanesulfonate.
| Compound Name | [3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol;[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethyl] methanesulfonate |
|---|---|
| PubChem CID | 159308339 |
| Molecular Formula | C17H18Cl2N2O8S |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | [3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethanol;[[3-[chloro(dideuterio)methyl]-5-nitrophenyl]-dideuteriomethyl] methanesulfonate |
| SMILES | [2H]C([2H])(Cl)c1cc([N+](=O)[O-])cc(C([2H])([2H])OS(C)(=O)=O)c1.[2H]C([2H])(O)c1cc([N+](=O)[O-])cc(C([2H])([2H])Cl)c1 |
| InChI | InChI=1S/C9H10ClNO5S.C8H8ClNO3/c1-17(14,15)16-6-8-2-7(5-10)3-9(4-8)11(12)13;9-4-6-1-7(5-11)3-8(2-6)10(12)13/h2-4H,5-6H2,1H3;1-3,11H,4-5H2/i5D2,6D2;4D2,5D2 |
| InChIKey | LCFARRXEBMOYSS-JDSSANBHSA-N |
| XLogP | 3.64 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|