C16H27NO8P2 — CID 132525939
1,3-bis(diethoxyphosphorylmethyl)-5-nitrobenzene (PubChem CID 132525939) has the molecular formula C16H27NO8P2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 1,3-bis(diethoxyphosphorylmethyl)-5-nitrobenzene.
| Compound Name | 1,3-bis(diethoxyphosphorylmethyl)-5-nitrobenzene |
|---|---|
| PubChem CID | 132525939 |
| Molecular Formula | C16H27NO8P2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 1,3-bis(diethoxyphosphorylmethyl)-5-nitrobenzene |
| SMILES | CCOP(=O)(Cc1cc(CP(=O)(OCC)OCC)cc([N+](=O)[O-])c1)OCC |
| InChI | InChI=1S/C16H27NO8P2/c1-5-22-26(20,23-6-2)12-14-9-15(11-16(10-14)17(18)19)13-27(21,24-7-3)25-8-4/h9-11H,5-8,12-13H2,1-4H3 |
| InChIKey | HJIPWVWCNUKERQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|