C22H28NO8P — CID 58329975
5-(diethoxyphosphorylmethyl)-1-methoxy-3-(methoxymethoxy)-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene (PubChem CID 58329975) has the molecular formula C22H28NO8P and a molecular weight of 465.44 g/mol. Its IUPAC name is 5-(diethoxyphosphorylmethyl)-1-methoxy-3-(methoxymethoxy)-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene.
| Compound Name | 5-(diethoxyphosphorylmethyl)-1-methoxy-3-(methoxymethoxy)-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 58329975 |
| Molecular Formula | C22H28NO8P |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 5-(diethoxyphosphorylmethyl)-1-methoxy-3-(methoxymethoxy)-2-[(E)-2-(4-nitrophenyl)ethenyl]benzene |
| SMILES | CCOP(=O)(Cc1cc(OC)c(/C=C/c2ccc([N+](=O)[O-])cc2)c(OCOC)c1)OCC |
| InChI | InChI=1S/C22H28NO8P/c1-5-30-32(26,31-6-2)15-18-13-21(28-4)20(22(14-18)29-16-27-3)12-9-17-7-10-19(11-8-17)23(24)25/h7-14H,5-6,15-16H2,1-4H3/b12-9+ |
| InChIKey | OOZNGBOHLWGCLK-FMIVXFBMSA-N |
| XLogP | 5.52 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|