C33H27N3O9 — CID 15542576
1,3,5-trimethoxy-2,4,6-tris[(E)-2-(4-nitrophenyl)ethenyl]benzene (PubChem CID 15542576) has the molecular formula C33H27N3O9 and a molecular weight of 609.59 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2,4,6-tris[(E)-2-(4-nitrophenyl)ethenyl]benzene.
| Compound Name | 1,3,5-trimethoxy-2,4,6-tris[(E)-2-(4-nitrophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 15542576 |
| Molecular Formula | C33H27N3O9 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | 1,3,5-trimethoxy-2,4,6-tris[(E)-2-(4-nitrophenyl)ethenyl]benzene |
| SMILES | COc1c(/C=C/c2ccc([N+](=O)[O-])cc2)c(OC)c(/C=C/c2ccc([N+](=O)[O-])cc2)c(OC)c1/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H27N3O9/c1-43-31-28(19-10-22-4-13-25(14-5-22)34(37)38)32(44-2)30(21-12-24-8-17-27(18-9-24)36(41)42)33(45-3)29(31)20-11-23-6-15-26(16-7-23)35(39)40/h4-21H,1-3H3/b19-10+,20-11+,21-12+ |
| InChIKey | ZEVMRCGBRPSLJG-AUCPOXKISA-N |
| XLogP | 7.95 |
| TPSA | 157.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|