C30H20N2O4 — CID 15074034
9,10-bis[(E)-2-(4-nitrophenyl)ethenyl]anthracene (PubChem CID 15074034) has the molecular formula C30H20N2O4 and a molecular weight of 472.50 g/mol. Its IUPAC name is 9,10-bis[(E)-2-(4-nitrophenyl)ethenyl]anthracene.
| Compound Name | 9,10-bis[(E)-2-(4-nitrophenyl)ethenyl]anthracene |
|---|---|
| PubChem CID | 15074034 |
| Molecular Formula | C30H20N2O4 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 9,10-bis[(E)-2-(4-nitrophenyl)ethenyl]anthracene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2c3ccccc3c(/C=C/c3ccc([N+](=O)[O-])cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H20N2O4/c33-31(34)23-15-9-21(10-16-23)13-19-29-25-5-1-2-6-26(25)30(28-8-4-3-7-27(28)29)20-14-22-11-17-24(18-12-22)32(35)36/h1-20H/b19-13+,20-14+ |
| InChIKey | RYIPHIYFUYUILW-IWGRKNQJSA-N |
| XLogP | 8.15 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|