C34H25NO2 — CID 122387898
1-[(E)-2-(4-nitrophenyl)ethenyl]-4-(1,2,2-triphenylethenyl)benzene (PubChem CID 122387898) has the molecular formula C34H25NO2 and a molecular weight of 479.58 g/mol. Its IUPAC name is 1-[(E)-2-(4-nitrophenyl)ethenyl]-4-(1,2,2-triphenylethenyl)benzene.
| Compound Name | 1-[(E)-2-(4-nitrophenyl)ethenyl]-4-(1,2,2-triphenylethenyl)benzene |
|---|---|
| PubChem CID | 122387898 |
| Molecular Formula | C34H25NO2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[(E)-2-(4-nitrophenyl)ethenyl]-4-(1,2,2-triphenylethenyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H25NO2/c36-35(37)32-24-20-27(21-25-32)17-16-26-18-22-31(23-19-26)34(30-14-8-3-9-15-30)33(28-10-4-1-5-11-28)29-12-6-2-7-13-29/h1-25H/b17-16+ |
| InChIKey | ZIEJZSSWJNJYHJ-WUKNDPDISA-N |
| XLogP | 8.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|