C18H15NO2 — CID 6258529
1-nitro-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene (PubChem CID 6258529) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-nitro-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene.
| Compound Name | 1-nitro-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 6258529 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-nitro-4-[(1E,3E,5E)-6-phenylhexa-1,3,5-trienyl]benzene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/C=C/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15NO2/c20-19(21)18-14-12-17(13-15-18)11-5-2-1-4-8-16-9-6-3-7-10-16/h1-15H/b2-1+,8-4+,11-5+ |
| InChIKey | AYKBAOXEJOHWEE-HOXLXQKJSA-N |
| XLogP | 4.88 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|