C11H9NO3 — CID 92856070
(2Z,4E)-5-(4-nitrophenyl)penta-2,4-dienal (PubChem CID 92856070) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is (2Z,4E)-5-(4-nitrophenyl)penta-2,4-dienal.
| Compound Name | (2Z,4E)-5-(4-nitrophenyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 92856070 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (2Z,4E)-5-(4-nitrophenyl)penta-2,4-dienal |
| SMILES | O=C/C=C\C=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H9NO3/c13-9-3-1-2-4-10-5-7-11(8-6-10)12(14)15/h1-9H/b3-1-,4-2+ |
| InChIKey | BKLWQDSDJBFRDF-HSFFGMMNSA-N |
| XLogP | 2.36 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|