C11H8N2O2 — CID 15061744
(2E,4E)-5-(4-nitrophenyl)penta-2,4-dienenitrile (PubChem CID 15061744) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is (2E,4E)-5-(4-nitrophenyl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(4-nitrophenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 15061744 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (2E,4E)-5-(4-nitrophenyl)penta-2,4-dienenitrile |
| SMILES | N#C/C=C/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H8N2O2/c12-9-3-1-2-4-10-5-7-11(8-6-10)13(14)15/h1-8H/b3-1+,4-2+ |
| InChIKey | KLJDOYFGMJRNCY-ZPUQHVIOSA-N |
| XLogP | 2.69 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|