C13H14N2O4 — CID 134907476
(2E,4E)-N-methoxy-N-methyl-5-(4-nitrophenyl)penta-2,4-dienamide (PubChem CID 134907476) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is (2E,4E)-N-methoxy-N-methyl-5-(4-nitrophenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-methoxy-N-methyl-5-(4-nitrophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 134907476 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2E,4E)-N-methoxy-N-methyl-5-(4-nitrophenyl)penta-2,4-dienamide |
| SMILES | CON(C)C(=O)/C=C/C=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14N2O4/c1-14(19-2)13(16)6-4-3-5-11-7-9-12(10-8-11)15(17)18/h3-10H,1-2H3/b5-3+,6-4+ |
| InChIKey | BBTPVLYVXLZUCV-GGWOSOGESA-N |
| XLogP | 2.18 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|