C19H15NO6 — CID 136792263
4-hydroxy-6-methyl-3-[(2E,4E,6E)-7-(4-nitrophenyl)hepta-2,4,6-trienoyl]pyran-2-one (PubChem CID 136792263) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[(2E,4E,6E)-7-(4-nitrophenyl)hepta-2,4,6-trienoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[(2E,4E,6E)-7-(4-nitrophenyl)hepta-2,4,6-trienoyl]pyran-2-one |
|---|---|
| PubChem CID | 136792263 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[(2E,4E,6E)-7-(4-nitrophenyl)hepta-2,4,6-trienoyl]pyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)/C=C/C=C/C=C/c2ccc([N+](=O)[O-])cc2)c(=O)o1 |
| InChI | InChI=1S/C19H15NO6/c1-13-12-17(22)18(19(23)26-13)16(21)7-5-3-2-4-6-14-8-10-15(11-9-14)20(24)25/h2-12,22H,1H3/b3-2+,6-4+,7-5+ |
| InChIKey | SVYBKGVKYJVONS-NYYLHBDNSA-N |
| XLogP | 3.57 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|