C15H13NO7 — CID 163130600
N,2-dihydroxy-5-[3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzeneamine oxide (PubChem CID 163130600) has the molecular formula C15H13NO7 and a molecular weight of 319.27 g/mol. Its IUPAC name is N,2-dihydroxy-5-[3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzeneamine oxide.
| Compound Name | N,2-dihydroxy-5-[3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163130600 |
| Molecular Formula | C15H13NO7 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N,2-dihydroxy-5-[3-(4-hydroxy-6-methyl-2-oxopyran-3-yl)-3-oxoprop-1-enyl]benzeneamine oxide |
| SMILES | Cc1cc(O)c(C(=O)C=Cc2ccc(O)c([NH+]([O-])O)c2)c(=O)o1 |
| InChI | InChI=1S/C15H13NO7/c1-8-6-13(19)14(15(20)23-8)12(18)5-3-9-2-4-11(17)10(7-9)16(21)22/h2-7,16-17,19,21H,1H3 |
| InChIKey | FZIJNAHYSPXARA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|