C19H20O4 — CID 143583119
ethane;4-hydroxy-6-methyl-3-[(2E,4E)-5-phenylpenta-2,4-dienoyl]pyran-2-one (PubChem CID 143583119) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethane;4-hydroxy-6-methyl-3-[(2E,4E)-5-phenylpenta-2,4-dienoyl]pyran-2-one.
| Compound Name | ethane;4-hydroxy-6-methyl-3-[(2E,4E)-5-phenylpenta-2,4-dienoyl]pyran-2-one |
|---|---|
| PubChem CID | 143583119 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ethane;4-hydroxy-6-methyl-3-[(2E,4E)-5-phenylpenta-2,4-dienoyl]pyran-2-one |
| SMILES | CC.Cc1cc(O)c(C(=O)/C=C/C=C/c2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C17H14O4.C2H6/c1-12-11-15(19)16(17(20)21-12)14(18)10-6-5-9-13-7-3-2-4-8-13;1-2/h2-11,19H,1H3;1-2H3/b9-5+,10-6+; |
| InChIKey | YHENIAFDHQDYPU-QJQFWQJTSA-N |
| XLogP | 4.13 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|