C16H14O6S — CID 136647119
4-hydroxy-6-methyl-3-[3-(4-methylsulfonylphenyl)prop-2-enoyl]pyran-2-one (PubChem CID 136647119) has the molecular formula C16H14O6S and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[3-(4-methylsulfonylphenyl)prop-2-enoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[3-(4-methylsulfonylphenyl)prop-2-enoyl]pyran-2-one |
|---|---|
| PubChem CID | 136647119 |
| Molecular Formula | C16H14O6S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[3-(4-methylsulfonylphenyl)prop-2-enoyl]pyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)C=Cc2ccc(S(C)(=O)=O)cc2)c(=O)o1 |
| InChI | InChI=1S/C16H14O6S/c1-10-9-14(18)15(16(19)22-10)13(17)8-5-11-3-6-12(7-4-11)23(2,20)21/h3-9,18H,1-2H3 |
| InChIKey | NQBQKGLJGPRNRC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|