C14H17NO4 — CID 136837053
4-hydroxy-6-methyl-3-[(Z)-3-piperidin-1-ylprop-2-enoyl]pyran-2-one (PubChem CID 136837053) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[(Z)-3-piperidin-1-ylprop-2-enoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[(Z)-3-piperidin-1-ylprop-2-enoyl]pyran-2-one |
|---|---|
| PubChem CID | 136837053 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[(Z)-3-piperidin-1-ylprop-2-enoyl]pyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)/C=C\N2CCCCC2)c(=O)o1 |
| InChI | InChI=1S/C14H17NO4/c1-10-9-12(17)13(14(18)19-10)11(16)5-8-15-6-3-2-4-7-15/h5,8-9,17H,2-4,6-7H2,1H3/b8-5- |
| InChIKey | JLBZECYIJRXUDH-YVMONPNESA-N |
| XLogP | 1.84 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|