C13H16O4 — CID 146342520
4-hydroxy-6-methyl-3-[(E)-4-methylhex-2-enoyl]pyran-2-one (PubChem CID 146342520) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[(E)-4-methylhex-2-enoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[(E)-4-methylhex-2-enoyl]pyran-2-one |
|---|---|
| PubChem CID | 146342520 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[(E)-4-methylhex-2-enoyl]pyran-2-one |
| SMILES | CCC(C)/C=C/C(=O)c1c(O)cc(C)oc1=O |
| InChI | InChI=1S/C13H16O4/c1-4-8(2)5-6-10(14)12-11(15)7-9(3)17-13(12)16/h5-8,15H,4H2,1-3H3/b6-5+ |
| InChIKey | BKRCMHIZHOZMPH-AATRIKPKSA-N |
| XLogP | 2.44 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|