C12H9NO4S — CID 136651970
4-hydroxy-6-methyl-3-[3-(1,3-thiazol-2-yl)prop-2-enoyl]pyran-2-one (PubChem CID 136651970) has the molecular formula C12H9NO4S and a molecular weight of 263.27 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[3-(1,3-thiazol-2-yl)prop-2-enoyl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[3-(1,3-thiazol-2-yl)prop-2-enoyl]pyran-2-one |
|---|---|
| PubChem CID | 136651970 |
| Molecular Formula | C12H9NO4S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[3-(1,3-thiazol-2-yl)prop-2-enoyl]pyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)C=Cc2nccs2)c(=O)o1 |
| InChI | InChI=1S/C12H9NO4S/c1-7-6-9(15)11(12(16)17-7)8(14)2-3-10-13-4-5-18-10/h2-6,15H,1H3 |
| InChIKey | MFPDDDOQXNDYHY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|