C7H7NOS — CID 54371892
4-(1,3-thiazol-2-yl)but-3-en-2-one (PubChem CID 54371892) has the molecular formula C7H7NOS and a molecular weight of 153.21 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)but-3-en-2-one.
| Compound Name | 4-(1,3-thiazol-2-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 54371892 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)but-3-en-2-one |
| SMILES | CC(=O)C=Cc1nccs1 |
| InChI | InChI=1S/C7H7NOS/c1-6(9)2-3-7-8-4-5-10-7/h2-5H,1H3 |
| InChIKey | UTUDCEAINKGFPF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|