C9H9NO3S — CID 141015434
methyl 2-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate (PubChem CID 141015434) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is methyl 2-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate.
| Compound Name | methyl 2-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate |
|---|---|
| PubChem CID | 141015434 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | methyl 2-oxo-5-(1,3-thiazol-2-yl)pent-4-enoate |
| SMILES | COC(=O)C(=O)CC=Cc1nccs1 |
| InChI | InChI=1S/C9H9NO3S/c1-13-9(12)7(11)3-2-4-8-10-5-6-14-8/h2,4-6H,3H2,1H3 |
| InChIKey | LUJKWBFMGYXHRK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|