C6H5NO2S — CID 171379273
(E)-3-(1,3-thiazol-2-yl)(1,2,3-13C3)prop-2-enoic acid (PubChem CID 171379273) has the molecular formula C6H5NO2S and a molecular weight of 158.16 g/mol. Its IUPAC name is (E)-3-(1,3-thiazol-2-yl)(1,2,3-13C3)prop-2-enoic acid.
| Compound Name | (E)-3-(1,3-thiazol-2-yl)(1,2,3-13C3)prop-2-enoic acid |
|---|---|
| PubChem CID | 171379273 |
| Molecular Formula | C6H5NO2S |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | (E)-3-(1,3-thiazol-2-yl)(1,2,3-13C3)prop-2-enoic acid |
| SMILES | O=[13C](O)/[13CH]=[13CH]/c1nccs1 |
| InChI | InChI=1S/C6H5NO2S/c8-6(9)2-1-5-7-3-4-10-5/h1-4H,(H,8,9)/b2-1+/i1+1,2+1,6+1 |
| InChIKey | PIWFCOHMNRSNNY-QMIQAWNJSA-N |
| XLogP | 1.24 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|