C14H12BrNO3S — CID 55994861
2-(4-bromophenoxy)ethyl (E)-3-(1,3-thiazol-2-yl)prop-2-enoate (PubChem CID 55994861) has the molecular formula C14H12BrNO3S and a molecular weight of 354.23 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl (E)-3-(1,3-thiazol-2-yl)prop-2-enoate.
| Compound Name | 2-(4-bromophenoxy)ethyl (E)-3-(1,3-thiazol-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55994861 |
| Molecular Formula | C14H12BrNO3S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl (E)-3-(1,3-thiazol-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1nccs1)OCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12BrNO3S/c15-11-1-3-12(4-2-11)18-8-9-19-14(17)6-5-13-16-7-10-20-13/h1-7,10H,8-9H2/b6-5+ |
| InChIKey | YSJKBUSCNUOOFE-AATRIKPKSA-N |
| XLogP | 3.54 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|