C6H6N2O2S — CID 70407075
(Z)-2-amino-3-(1,3-thiazol-2-yl)prop-2-enoic acid (PubChem CID 70407075) has the molecular formula C6H6N2O2S and a molecular weight of 170.19 g/mol. Its IUPAC name is (Z)-2-amino-3-(1,3-thiazol-2-yl)prop-2-enoic acid.
| Compound Name | (Z)-2-amino-3-(1,3-thiazol-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 70407075 |
| Molecular Formula | C6H6N2O2S |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | (Z)-2-amino-3-(1,3-thiazol-2-yl)prop-2-enoic acid |
| SMILES | N/C(=C\c1nccs1)C(=O)O |
| InChI | InChI=1S/C6H6N2O2S/c7-4(6(9)10)3-5-8-1-2-11-5/h1-3H,7H2,(H,9,10)/b4-3- |
| InChIKey | ZDWNMLBUBIOXIU-ARJAWSKDSA-N |
| XLogP | 0.53 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|