About (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid
(E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid (PubChem CID 104830981) has the molecular formula C7H8N2O2S
and a molecular weight of 184.22 g/mol. Its IUPAC name is (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid.
Molecular Properties
| Compound Name | (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid |
| PubChem CID | 104830981 |
| Molecular Formula | C7H8N2O2S |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid |
| SMILES | N/C(=C/Cc1nccs1)C(=O)O |
| InChI | InChI=1S/C7H8N2O2S/c8-5(7(10)11)1-2-6-9-3-4-12-6/h1,3-4H,2,8H2,(H,10,11)/b5-1+ |
| InChIKey | NECWHLDRIGRUGY-ORCRQEGFSA-N |
| XLogP | 0.61 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid?
The IUPAC name of (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid (CID 104830981) is (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid.
What is the SMILES notation for (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid?
The canonical SMILES for (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid is N/C(=C/Cc1nccs1)C(=O)O.
What is the InChIKey of (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid?
The InChIKey is NECWHLDRIGRUGY-ORCRQEGFSA-N. The full InChI is InChI=1S/C7H8N2O2S/c8-5(7(10)11)1-2-6-9-3-4-12-6/h1,3-4H,2,8H2,(H,10,11)/b5-1+.
What are the key properties of (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid?
(E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid has a molecular weight of 184.22 g/mol, XLogP of 0.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-amino-4-(1,3-thiazol-2-yl)but-2-enoic acid is sourced from PubChem (CID 104830981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).