C7H12N4OS — CID 83110656
2-(1,3-thiazol-2-ylmethylamino)ethylurea (PubChem CID 83110656) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylmethylamino)ethylurea.
| Compound Name | 2-(1,3-thiazol-2-ylmethylamino)ethylurea |
|---|---|
| PubChem CID | 83110656 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-(1,3-thiazol-2-ylmethylamino)ethylurea |
| SMILES | NC(=O)NCCNCc1nccs1 |
| InChI | InChI=1S/C7H12N4OS/c8-7(12)11-2-1-9-5-6-10-3-4-13-6/h3-4,9H,1-2,5H2,(H3,8,11,12) |
| InChIKey | QGVIPTWWDNONEI-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|