C6H8N2OS2 — CID 56981215
2-(1,3-thiazol-2-ylmethylsulfanyl)acetamide (PubChem CID 56981215) has the molecular formula C6H8N2OS2 and a molecular weight of 188.28 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylmethylsulfanyl)acetamide.
| Compound Name | 2-(1,3-thiazol-2-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 56981215 |
| Molecular Formula | C6H8N2OS2 |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 2-(1,3-thiazol-2-ylmethylsulfanyl)acetamide |
| SMILES | NC(=O)CSCc1nccs1 |
| InChI | InChI=1S/C6H8N2OS2/c7-5(9)3-10-4-6-8-1-2-11-6/h1-2H,3-4H2,(H2,7,9) |
| InChIKey | FDSHOOBVHMAUKZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |