C7H12N4S2 — CID 20567731
2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 20567731) has the molecular formula C7H12N4S2 and a molecular weight of 216.34 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 20567731 |
| Molecular Formula | C7H12N4S2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | NC(N)=NCCSCc1nccs1 |
| InChI | InChI=1S/C7H12N4S2/c8-7(9)11-1-3-12-5-6-10-2-4-13-6/h2,4H,1,3,5H2,(H4,8,9,11) |
| InChIKey | WRTVKLOTXROGKS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|