C14H22N6OS3 — CID 173446355
1-hydroxy-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 173446355) has the molecular formula C14H22N6OS3 and a molecular weight of 386.57 g/mol. Its IUPAC name is 1-hydroxy-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-hydroxy-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 173446355 |
| Molecular Formula | C14H22N6OS3 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-hydroxy-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | Cc1[nH]cnc1CSCCN/C(=N/CCSCc1nccs1)NO |
| InChI | InChI=1S/C14H22N6OS3/c1-11-12(19-10-18-11)8-22-5-2-16-14(20-21)17-3-6-23-9-13-15-4-7-24-13/h4,7,10,21H,2-3,5-6,8-9H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | ZNUQGPSWBHEMQZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|