C15H23N7O2S — CID 110182748
N-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-oxobutanamide (PubChem CID 110182748) has the molecular formula C15H23N7O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-oxobutanamide.
| Compound Name | N-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 110182748 |
| Molecular Formula | C15H23N7O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NCCN/C(=N/CCSCc1nc[nH]c1C)NC#N |
| InChI | InChI=1S/C15H23N7O2S/c1-11(23)7-14(24)17-3-4-18-15(20-9-16)19-5-6-25-8-13-12(2)21-10-22-13/h10H,3-8H2,1-2H3,(H,17,24)(H,21,22)(H2,18,19,20) |
| InChIKey | VUNSCEVBKKKXLI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|