C20H32N12S2 — CID 87207464
1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 87207464) has the molecular formula C20H32N12S2 and a molecular weight of 504.69 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 87207464 |
| Molecular Formula | C20H32N12S2 |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1nc[nH]c1C.C/N=C(\NC#N)NCCSCc1nc[nH]c1C |
| InChI | InChI=1S/2C10H16N6S/c2*1-8-9(16-7-15-8)5-17-4-3-13-10(12-2)14-6-11/h2*7H,3-5H2,1-2H3,(H,15,16)(H2,12,13,14) |
| InChIKey | OUHXQCMGQCFMIZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 177.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|