C20H30N12S2 — CID 110182409
1-cyano-3-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 110182409) has the molecular formula C20H30N12S2 and a molecular weight of 502.68 g/mol. Its IUPAC name is 1-cyano-3-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-cyano-3-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 110182409 |
| Molecular Formula | C20H30N12S2 |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 1-cyano-3-[2-[[N-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | Cc1[nH]cnc1CSCC/N=C(\NC#N)NCCN/C(=N/CCSCc1nc[nH]c1C)NC#N |
| InChI | InChI=1S/C20H30N12S2/c1-15-17(31-13-29-15)9-33-7-5-25-19(27-11-21)23-3-4-24-20(28-12-22)26-6-8-34-10-18-16(2)30-14-32-18/h13-14H,3-10H2,1-2H3,(H,29,31)(H,30,32)(H2,23,25,27)(H2,24,26,28) |
| InChIKey | FPNMKHPEZMAUHN-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 177.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|