C13H23N7OS — CID 110182484
1-cyano-2-[2-(2-hydroxyethylamino)ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine (PubChem CID 110182484) has the molecular formula C13H23N7OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 1-cyano-2-[2-(2-hydroxyethylamino)ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 1-cyano-2-[2-(2-hydroxyethylamino)ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 110182484 |
| Molecular Formula | C13H23N7OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-cyano-2-[2-(2-hydroxyethylamino)ethyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine |
| SMILES | Cc1[nH]cnc1CSCCN/C(=N/CCNCCO)NC#N |
| InChI | InChI=1S/C13H23N7OS/c1-11-12(20-10-19-11)8-22-7-5-17-13(18-9-14)16-3-2-15-4-6-21/h10,15,21H,2-8H2,1H3,(H,19,20)(H2,16,17,18) |
| InChIKey | DHDVCWALGLRMKG-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|