C10H17BrN4O2S — CID 70513585
2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-methyliminoacetic acid;hydrobromide (PubChem CID 70513585) has the molecular formula C10H17BrN4O2S and a molecular weight of 337.24 g/mol. Its IUPAC name is 2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-methyliminoacetic acid;hydrobromide.
| Compound Name | 2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-methyliminoacetic acid;hydrobromide |
|---|---|
| PubChem CID | 70513585 |
| Molecular Formula | C10H17BrN4O2S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-methyliminoacetic acid;hydrobromide |
| SMILES | Br.C/N=C(/NCCSCc1nc[nH]c1C)C(=O)O |
| InChI | InChI=1S/C10H16N4O2S.BrH/c1-7-8(14-6-13-7)5-17-4-3-12-9(11-2)10(15)16;/h6H,3-5H2,1-2H3,(H,11,12)(H,13,14)(H,15,16);1H |
| InChIKey | GSZQZHQIVVBOIK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|