C14H22N6OS — CID 13499406
1-[3-(1H-imidazol-5-yl)propyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]urea (PubChem CID 13499406) has the molecular formula C14H22N6OS and a molecular weight of 322.44 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-5-yl)propyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]urea.
| Compound Name | 1-[3-(1H-imidazol-5-yl)propyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 13499406 |
| Molecular Formula | C14H22N6OS |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-[3-(1H-imidazol-5-yl)propyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]urea |
| SMILES | Cc1[nH]cnc1CSCCNC(=O)NCCCc1cnc[nH]1 |
| InChI | InChI=1S/C14H22N6OS/c1-11-13(20-10-18-11)8-22-6-5-17-14(21)16-4-2-3-12-7-15-9-19-12/h7,9-10H,2-6,8H2,1H3,(H,15,19)(H,18,20)(H2,16,17,21) |
| InChIKey | ODOGJOLRXWISFI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|