C15H25N7S — CID 19830954
1-[3-(1H-imidazol-5-yl)propyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]propyl]guanidine (PubChem CID 19830954) has the molecular formula C15H25N7S and a molecular weight of 335.48 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-5-yl)propyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]propyl]guanidine.
| Compound Name | 1-[3-(1H-imidazol-5-yl)propyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]propyl]guanidine |
|---|---|
| PubChem CID | 19830954 |
| Molecular Formula | C15H25N7S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[3-(1H-imidazol-5-yl)propyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]propyl]guanidine |
| SMILES | Cc1[nH]cnc1CSC(C)C/N=C(\N)NCCCc1cnc[nH]1 |
| InChI | InChI=1S/C15H25N7S/c1-11(23-8-14-12(2)20-10-22-14)6-19-15(16)18-5-3-4-13-7-17-9-21-13/h7,9-11H,3-6,8H2,1-2H3,(H,17,21)(H,20,22)(H3,16,18,19) |
| InChIKey | BXUYTPGTAIQRSP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|