C8H15N5 — CID 13499387
1-[3-(1H-imidazol-5-yl)propyl]-2-methylguanidine (PubChem CID 13499387) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-5-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[3-(1H-imidazol-5-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 13499387 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-[3-(1H-imidazol-5-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCCc1cnc[nH]1 |
| InChI | InChI=1S/C8H15N5/c1-10-8(9)12-4-2-3-7-5-11-6-13-7/h5-6H,2-4H2,1H3,(H,11,13)(H3,9,10,12) |
| InChIKey | BDCZRBRMRNIOFR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|