C15H27N3O2 — CID 10564790
3-(1H-imidazol-5-yl)propyl N-octylcarbamate (PubChem CID 10564790) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-octylcarbamate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-octylcarbamate |
|---|---|
| PubChem CID | 10564790 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C15H27N3O2/c1-2-3-4-5-6-7-10-17-15(19)20-11-8-9-14-12-16-13-18-14/h12-13H,2-11H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | QPDNLSQYYWFXMU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|