C17H25N3O6 — CID 54583422
(Z)-but-2-enedioic acid;3-(1H-imidazol-5-yl)propyl N-[(E)-hex-2-enyl]carbamate (PubChem CID 54583422) has the molecular formula C17H25N3O6 and a molecular weight of 367.40 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-(1H-imidazol-5-yl)propyl N-[(E)-hex-2-enyl]carbamate.
| Compound Name | (Z)-but-2-enedioic acid;3-(1H-imidazol-5-yl)propyl N-[(E)-hex-2-enyl]carbamate |
|---|---|
| PubChem CID | 54583422 |
| Molecular Formula | C17H25N3O6 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-(1H-imidazol-5-yl)propyl N-[(E)-hex-2-enyl]carbamate |
| SMILES | CCC/C=C/CNC(=O)OCCCc1cnc[nH]1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C13H21N3O2.C4H4O4/c1-2-3-4-5-8-15-13(17)18-9-6-7-12-10-14-11-16-12;5-3(6)1-2-4(7)8/h4-5,10-11H,2-3,6-9H2,1H3,(H,14,16)(H,15,17);1-2H,(H,5,6)(H,7,8)/b5-4+;2-1- |
| InChIKey | JNPDXGCZADLGRM-WCNLUQOZSA-N |
| XLogP | 2.14 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|