C13H14ClN3O2 — CID 10062176
3-(1H-imidazol-5-yl)propyl N-(4-chlorophenyl)carbamate (PubChem CID 10062176) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-(4-chlorophenyl)carbamate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 10062176 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)cc1)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H14ClN3O2/c14-10-3-5-11(6-4-10)17-13(18)19-7-1-2-12-8-15-9-16-12/h3-6,8-9H,1-2,7H2,(H,15,16)(H,17,18) |
| InChIKey | WAJSVOHYTCATPJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|