C13H21N3O4 — CID 10334021
methyl (2S)-2-[3-(1H-imidazol-5-yl)propoxycarbonylamino]-3-methylbutanoate (PubChem CID 10334021) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl (2S)-2-[3-(1H-imidazol-5-yl)propoxycarbonylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[3-(1H-imidazol-5-yl)propoxycarbonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10334021 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | methyl (2S)-2-[3-(1H-imidazol-5-yl)propoxycarbonylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OCCCc1cnc[nH]1)C(C)C |
| InChI | InChI=1S/C13H21N3O4/c1-9(2)11(12(17)19-3)16-13(18)20-6-4-5-10-7-14-8-15-10/h7-9,11H,4-6H2,1-3H3,(H,14,15)(H,16,18)/t11-/m0/s1 |
| InChIKey | ZHSOZQBVETXYTO-NSHDSACASA-N |
| XLogP | 1.27 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|