C11H15N3O4 — CID 107876519
methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enoxycarbonylamino)propanoate (PubChem CID 107876519) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 107876519 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)OC |
| InChI | InChI=1S/C11H15N3O4/c1-3-4-18-11(16)14-9(10(15)17-2)5-8-6-12-7-13-8/h3,6-7,9H,1,4-5H2,2H3,(H,12,13)(H,14,16)/t9-/m0/s1 |
| InChIKey | KBRARKSYZLPENL-VIFPVBQESA-N |
| XLogP | 0.41 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|