C10H15N3O4S — CID 107876590
methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enylsulfonylamino)propanoate (PubChem CID 107876590) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enylsulfonylamino)propanoate.
| Compound Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 107876590 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-(prop-2-enylsulfonylamino)propanoate |
| SMILES | C=CCS(=O)(=O)N[C@@H](Cc1cnc[nH]1)C(=O)OC |
| InChI | InChI=1S/C10H15N3O4S/c1-3-4-18(15,16)13-9(10(14)17-2)5-8-6-11-7-12-8/h3,6-7,9,13H,1,4-5H2,2H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | SEJSPNINRQXACX-VIFPVBQESA-N |
| XLogP | -0.40 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|