C11H20N4O4S — CID 107876610
methyl (2S)-2-(diethylsulfamoylamino)-3-(1H-imidazol-5-yl)propanoate (PubChem CID 107876610) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is methyl (2S)-2-(diethylsulfamoylamino)-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2S)-2-(diethylsulfamoylamino)-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 107876610 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl (2S)-2-(diethylsulfamoylamino)-3-(1H-imidazol-5-yl)propanoate |
| SMILES | CCN(CC)S(=O)(=O)N[C@@H](Cc1cnc[nH]1)C(=O)OC |
| InChI | InChI=1S/C11H20N4O4S/c1-4-15(5-2)20(17,18)14-10(11(16)19-3)6-9-7-12-8-13-9/h7-8,10,14H,4-6H2,1-3H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | MKBVJRXJZRFLFJ-JTQLQIEISA-N |
| XLogP | -0.33 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |