C9H12N4O4S — CID 114011823
methyl (2S)-2-(cyanomethylsulfonylamino)-3-(1H-imidazol-5-yl)propanoate (PubChem CID 114011823) has the molecular formula C9H12N4O4S and a molecular weight of 272.29 g/mol. Its IUPAC name is methyl (2S)-2-(cyanomethylsulfonylamino)-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl (2S)-2-(cyanomethylsulfonylamino)-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 114011823 |
| Molecular Formula | C9H12N4O4S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | methyl (2S)-2-(cyanomethylsulfonylamino)-3-(1H-imidazol-5-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cnc[nH]1)NS(=O)(=O)CC#N |
| InChI | InChI=1S/C9H12N4O4S/c1-17-9(14)8(4-7-5-11-6-12-7)13-18(15,16)3-2-10/h5-6,8,13H,3-4H2,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | BQWVEUGZSWJGOX-QMMMGPOBSA-N |
| XLogP | -1.06 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |