C8H10F3N3O2 — CID 19710619
3-(1H-imidazol-5-yl)propyl N-(trifluoromethyl)carbamate (PubChem CID 19710619) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-(trifluoromethyl)carbamate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 19710619 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-(trifluoromethyl)carbamate |
| SMILES | O=C(NC(F)(F)F)OCCCc1cnc[nH]1 |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)14-7(15)16-3-1-2-6-4-12-5-13-6/h4-5H,1-3H2,(H,12,13)(H,14,15) |
| InChIKey | ZLVNAKBATOCWSM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|