C18H26ClNO4 — CID 59366004
6-[(4-chlorophenyl)carbamoyloxy]hexyl 2-methylbutanoate (PubChem CID 59366004) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)carbamoyloxy]hexyl 2-methylbutanoate.
| Compound Name | 6-[(4-chlorophenyl)carbamoyloxy]hexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 59366004 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 6-[(4-chlorophenyl)carbamoyloxy]hexyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCOC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO4/c1-3-14(2)17(21)23-12-6-4-5-7-13-24-18(22)20-16-10-8-15(19)9-11-16/h8-11,14H,3-7,12-13H2,1-2H3,(H,20,22) |
| InChIKey | PMLMHODCKRELAU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|